| Identification | |
| Name: | Pyridine,2-methyl-3-nitro- |
| Synonyms: | 3-Nitro-2-methylpyridine;3-Nitro-2-picoline;NSC 311455;2-Picoline,3-nitro- (7CI,8CI);2-Methyl-3-nitropyridine; |
| CAS: | 18699-87-1 |
| Molecular Formula: | C6H6N2O2 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C6H6N2O2/c1-5-6(8(9)10)3-2-4-7-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.246 g/cm3 |
| Refractive index: | 1.558 |
| Appearance: | Yellow liquid or crystals |
| Specification: |
The 2-Methyl-3-nitropyridine is also its systematic name and IUPAC name. Its cas registry number is 18699-87-1. According to its molecular structure, this chemical belongs to the categories in nitro; pyridine; pyridines. Physical properties about this chemical are: (1)ACD/LogP: 1.03; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Index of Refraction: 1.558; (7)Molar Refractivity: 35.71 cm3; (8)Molar Volume: 110.7 cm3; (9)Surface Tension: 49.9 dyne/cm; (10)Density: 1.246 g/cm3; (11)Flash Point: 83.1 °C; (12)Enthalpy of Vaporization: 43.18 kJ/mol; (13)Boiling Point: 213.8 °C at 760 mmHg; (14)Vapour Pressure: 0.235 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
