| Identification | |
| Synonyms: | Diphenylacetyl chloride |
| CAS: | 1871-76-7 |
| EINECS: | 217-493-5 |
| Molecular Formula: | C14H11ClO |
| Molecular Weight: | 230.69 |
| InChI: | InChI=1/C14H11ClO/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.185 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.583 |
| Water Solubility: | MAY DECOMPOSE with water |
| Solubility: | MAY DECOMPOSE with water |
| Appearance: | slightly yellow Crystalline powder |
| Specification: |
2,2-Diphenylacetyl chloride ,its CAS NO. is 1871-76-7,the synonyms is 2,2-Diphenylacetylchloride ; Acetyl chloride, diphenyl- ; Alpha,alpha-Diphenylacetyl chloride ; Alpha,alpha-diphenylacetylchloride ; Benzeneacetyl chloride, alpha-phenyl- ; Diphenylacetic acid chloride ; Aiphenylaceticacidchloride . |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Corrosives area. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
