| Identification | |
| Name: | 1H-Pyrazole-4-methanol,1,3,5-trimethyl- |
| Synonyms: | Pyrazole-4-methanol,1,3,5-trimethyl- (6CI,7CI,8CI); |
| CAS: | 18712-39-5 |
| Molecular Formula: | C7H12N2O |
| Molecular Weight: | 140.18 |
| InChI: | InChI=1/C7H12N2O/c1-5-7(4-10)6(2)9(3)8-5/h10H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.536 |
| Specification: |
The (1,3,5-Trimethyl-1H-pyrazol-4-yl)methanol, with CAS registry number 18712-39-5, has the systematic name of (1,3,5-trimethyl-1H-pyrazol-4-yl)methanol. Besides this, it is also called 1H-Pyrazole-4-methanol, 1,3,5-trimethyl-. And the chemical formula of this chemical is C7H12N2O. Physical properties of (1,3,5-Trimethyl-1H-pyrazol-4-yl)methanol: (1)ACD/LogP: -0.10; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 27.05 Å2; (7)Index of Refraction: 1.536; (8)Molar Refractivity: 39.55 cm3; (9)Molar Volume: 126.7 cm3; (10)Polarizability: 15.68×10-24cm3; (11)Surface Tension: 34.3 dyne/cm; (12)Enthalpy of Vaporization: 52.99 kJ/mol; (13)Vapour Pressure: 0.00507 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
