| Identification |
| Name: | Quinoline,2-(4,5-dihydro-1H-imidazol-2-yl)- |
| Synonyms: | BU 224 |
| CAS: | 187173-05-3 |
| Molecular Formula: | C12H11 N3 |
| Molecular Weight: | 233.7 |
| InChI: | InChI=1/C12H11N3.ClH/c1-2-4-10-9(3-1)5-6-11(15-10)12-13-7-8-14-12;/h1-6H,7-8H2,(H,13,14);1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 179.3°C |
| Boiling Point: | 372.9°Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | High affinity ligand for the imidazoline I 2 binding site (K i = 2.1 nM). Putative I 2 antagonist; antagonizes the effects of imidazoline ligands on morphine antinociception. Produces ipsiversive rotational behavior in rats with a full 6-OHDA lesion of the nigrostriatal tract. |
| Flash Point: | 179.3°C |
| Color: | white |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
