| Identification | |
| Name: | Benzaldehyde,2,3-difluoro-6-methoxy- |
| Synonyms: | 2,3-Difluoro-6-methoxybenzaldehyde;5,6-Difluoro-2-methoxybenzaldehyde |
| CAS: | 187543-87-9 |
| Molecular Formula: | C8H6 F2 O2 |
| Molecular Weight: | 172.13 |
| InChI: | InChI=1/C8H6F2O2/c1-12-7-3-2-6(9)8(10)5(7)4-11/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 55-57 |
| Flash Point: | 92.1°C |
| Boiling Point: | 233°Cat760mmHg |
| Density: | 1.289g/cm3 |
| Refractive index: | 1.506 |
| Specification: |
2,3-Difluoro-6-methoxybenzaldehyde (187543-87-9) is the organic compound with the formula C8H6F2O2.it is air sensitive,The product categories about it are Aromatic Aldehydes & Derivatives (substituted) ; Benzaldehyde and the chemical synonymous are 2,3-Difluoro-6-methoxybenzaldehyde ; benzaldehyde, 2,3-difluoro-6-methoxy- . |
| Flash Point: | 92.1°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant/AirSensitive
|
 |
|
