| Identification | |
| Name: | Ethyl 3,4,5-trimethoxycinnamate |
| Synonyms: | Ethyl 3-(3,4,5-trimethoxyphenyl)acrylate;3-(3,4,5-Trimethoxyphenyl)-2-propenoic acid ethyl ester; |
| CAS: | 1878-29-1 |
| EINECS: | 217-516-9 |
| Molecular Formula: | C14H18O5 |
| Molecular Weight: | 266.29 |
| InChI: | InChI=1/C14H18O5/c1-5-19-13(15)7-6-10-8-11(16-2)14(18-4)12(9-10)17-3/h6-9H,5H2,1-4H3/b7-6+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.9 °C |
| Boiling Point: | 384 °Cat760mmHg |
| Density: | 1.114g/cm3 |
| Refractive index: | 1.525 |
| Appearance: | Light-yellowish liquid |
| Specification: |
Ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate , its cas register number 1878-29-1. It also can be called 2-Propenoic acid, 3-(3,4,5-trimethoxyphenyl)-, ethyl ester, (2E)- ; and Ethyl (2E)-3-(3,4,5-trimethoxyphenyl)acrylate . |
| Flash Point: | 168.9 °C |
| Safety Data | |
 |
|
