| Identification | |
| Name: | Propanoyl chloride,2,3-dibromo- |
| Synonyms: | Propionylchloride, 2,3-dibromo- (8CI);2,3-Dibromopropanoyl chloride;a,b-Dibromopropionyl chloride; |
| CAS: | 18791-02-1 |
| EINECS: | 242-575-2 |
| Molecular Formula: | C3H3Br2ClO |
| Molecular Weight: | 250.32 |
| InChI: | InChI=1/C3H3Br2ClO/c4-1-2(5)3(6)7/h2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 2.181 |
| Refractive index: | 1.542-1.546 |
| Alpha: | 22 º (C=8,6N HCL) |
| Specification: |
2,3-Dibromopropanoyl chloride (18791-02-1) is a colorless liqiud with acrid odor. It is mainly used as a medicine, agricultural chemical and leather dye intermediate. It should store under dry inert gas and in cool, dry conditions in well sealed containers. |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
