Identification |
Name: | 2-Thiophenecarboxaldehyde,4-bromo- |
Synonyms: | 3-Bromo-5-formylthiophene;3-Bromo-5-thiophenecarboxaldehyde;4-Bromo-2-formylthiophene;4-Bromo-2-thiophenecarboxaldehyde;4-Bromothiophen-2-aldehyde; |
CAS: | 18791-75-8 |
EINECS: | 242-577-3 |
Molecular Formula: | C5H3BrOS |
Molecular Weight: | 191.04 |
InChI: | InChI=1/C5H3BrOS/c6-4-1-5(2-7)8-3-4/h1-3H |
Molecular Structure: |
|
Properties |
Flash Point: | 108.3°C |
Density: | 1.789g/cm3 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.652 |
Appearance: | Pale yellow to light brown solid. |
Flash Point: | 108.3°C |
Storage Temperature: | 2-8°C |
Sensitive: | Air Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|