| Identification |
| Name: | 1H-Pyrrole-3-propanoicacid, 5-formyl-2,4-dimethyl-, methyl ester |
| Synonyms: | Pyrrole-3-propionicacid, 5-formyl-2,4-dimethyl-, methyl ester (8CI) |
| CAS: | 18818-25-2 |
| Molecular Formula: | C11H15 N O3 |
| Molecular Weight: | 209.24 |
| InChI: | InChI=1/C11H15NO3/c1-7-9(4-5-11(14)15-3)8(2)12-10(7)6-13/h6,12H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 158.271°C |
| Boiling Point: | 338.09°C at 760 mmHg |
| Density: | 1.154g/cm3 |
| Refractive index: | 1.549 |
| Flash Point: | 158.271°C |
| Usage: | An important precursor for the preparation of Hemes and Porphyrins |
| Safety Data |
| |
 |
