| Identification |
| Name: | Butanoicacid, 2,4-diamino-, hydrochloride (1:2), (2S)- |
| Synonyms: | H-Dab-OH;Butanoicacid, 2,4-diamino-, dihydrochloride, (2S)- (9CI);Butanoic acid, 2,4-diamino-,dihydrochloride, (S)-;Butyric acid, 2,4-diamino-, dihydrochloride, L- (8CI);L-2,4-Diaminobutanoic acid dihydrochloride;L-2,4-Diaminobutyric aciddihydrochloride;Butanoic acid, 2,4-diamino-, dihydrochloride; |
| CAS: | 1883-09-6 |
| EINECS: | 217-542-0 |
| Molecular Formula: | C4H10N2O2.2(HCl) |
| Molecular Weight: | 191.06 |
| InChI: | InChI=1/C4H10N2O2.2ClH/c5-2-1-3(6)4(7)8;;/h3H,1-2,5-6H2,(H,7,8);2*1H |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 14 o (C=3.7, H2O 16 oC) |
| Appearance: | White solid. |
| Usage: | A pharmacological tool and potential chiral building block. It is also used as an internal standard for amino acid analysis. Also found to inhibit GABA transaminase, thus producing an elevation of GABA level, and to have an antitumor activity in v |
| Safety Data |
| |
 |
