| Identification | |
| Name: | 2,5-Furandimethanol |
| Synonyms: | 2,5-Bis(hydroxymethyl)furan;2,5-Di(hydroxymethyl)furan;5-(Hydroxymethyl)furfuryl alcohol;FaRez 6305;NSC40737;NSC 524614; |
| CAS: | 1883-75-6 |
| EINECS: | 217-544-1 |
| Molecular Formula: | C6H8O3 |
| Molecular Weight: | 128.13 |
| InChI: | InChI=1/C6H8O3/c7-3-5-1-2-6(4-8)9-5/h1-2,7-8H,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 74-77 ºC |
| Flash Point: | 120 ºC |
| Boiling Point: | 275 ºC |
| Density: | 1.283 |
| Refractive index: | 1.542 |
| Appearance: | Off-white to pale yellow solid |
| Specification: |
2,5-Furandimethanol (CAS NO.1883-75-6) is also named as 2,5-Bis(hydroxymethyl)furan ; NSC 40737 ; NSC 524614 ; 2,5-Furandimethanol ; Furan-2,5-diyldimethanol . 2,5-Furandimethanol (CAS NO.1883-75-6) is off-white to pale yellow solid. |
| Flash Point: | 120 ºC |
| Safety Data | |
 |
|
