| Identification | |
| Name: | 6-Methyl-2-(4-methylphenyl)imidazol[1,2-a]-pyridine-3-acetic acid |
| Synonyms: | Zolpidicacid;2-(4-Methylphenyl)-6-methylimidazole[1,2-a]-pyridine-3-acetic Acid;imidazo[1,2-a]pyridine-3-acetic acid, 6-methyl-2-(4-methylphenyl)-;[6-Methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid; |
| CAS: | 189005-44-5 |
| Molecular Formula: | C17H16N2O2 |
| Molecular Weight: | 280.33 |
| InChI: | InChI=1/C17H16N2O2/c1-11-3-6-13(7-4-11)17-14(9-16(20)21)19-10-12(2)5-8-15(19)18-17/h3-8,10H,9H2,1-2H3,(H,20,21) |
| Molecular Structure: | ![(C17H16N2O2) Zolpidicacid;2-(4-Methylphenyl)-6-methylimidazole[1,2-a]-pyridine-3-acetic Acid;imidazo[1,2-a]pyridi...](https://img.guidechem.com/casimg/189005-44-5.gif) |
| Properties | |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.631 |
| Appearance: | Off-White to Pale Beige Solid |
| Specification: |
6-Methyl-2-(4-methylphenyl)imidazol[1,2-a]-pyridine-3-acetic acid, with CAS number of 189005-44-5, can be called [6-Methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid ; imidazo[1,2-a]pyridine-3-acetic acid, 6-methyl-2-(4-methylphenyl)- ; 2-(4-Methylphenyl)-6-methylimidazole[1,2-a]-pyridine-3-acetic Acid . It is an off-white to pale beige solid. 6-Methyl-2-(4-methylphenyl)imidazol[1,2-a]-pyridine-3-acetic acid (CAS NO.189005-44-5) can be as an intermediate in the synthesis of Zolpidem. |
| Usage: | An intermediate in the synthesis of Zolpidem |
| Safety Data | |
 |
|
