| Identification | |
| Name: | Magnesium,bis[2-(hydroxy-kO)propanoato-kO]-, (T-4)- |
| Synonyms: | Magnesiumlactate (6CI,7CI);Magnesium, bis(2-hydroxypropanoato-O1,O2)-, (T-4)-;Magnesium, bis(lactato)- (8CI);Propanoic acid, 2-hydroxy-, magnesium complex;Promagsan;Magnesium lactate; |
| CAS: | 18917-93-6 |
| EINECS: | 242-671-4 |
| Molecular Formula: | C6H10 Mg O6 |
| Molecular Weight: | 256.49 |
| InChI: | InChI=1/C3H6O3.Mg/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+2/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 41oC |
| Appearance: | White powder |
| Report: | Reported in EPA TSCA Inventory. Safety Profile
A poison by intravenous route. When heated to decomposition it emits toxic vapors of magnesium. |
| Safety Data | |
 |
|
