| Identification | |
| Name: | 10H-Phenothiazine-10-carbonylchloride |
| Synonyms: | Phenothiazine-10-carbonylchloride (6CI,7CI,8CI); 10-Chlorocarbonylphenothiazine;N-(Chlorocarbonyl)phenothiazine; Phenothiazine-N-carbonyl chloride |
| CAS: | 18956-87-1 |
| EINECS: | 242-699-7 |
| Molecular Formula: | C13H8 Cl N O S |
| Molecular Weight: | 261.72 |
| InChI: | InChI=1/C13H8ClNOS/c14-13(16)15-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)15/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205.4°C |
| Boiling Point: | 416.1°Cat760mmHg |
| Density: | 1.432g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.523 |
| Solubility: | Insoluble |
| Appearance: | Green gray powder. |
| Specification: |
10H-Phenothiazine-10-carbonylchloride , with CAS number of 18956-87-1, can be called 10H-phenothiazine-10-carbonyl chloride ; phenothiazine-10-carbonyl chloride ; phenothiazine-n-carbonyl chloride ; phenothiazine-10-carbonylchloride98% ; 10-Chlorocarbonylphenothiazine ; 10H-Phenothiazine-10-car ; N-(Chlorocarbonyl)phenothiazine ; Phenothiazine-10-carbonyl chloride 98% . It is a light green or yellow-brown crystalline powder. |
| Flash Point: | 205.4°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
