| Identification | |
| Name: | (E)-4-Phenyl-3-buten-2-one |
| Synonyms: | 3-Buten-2-one,4-phenyl-, (E)- (8CI);(4E)-4-Phenylbut-3-en-2-one;(E)-Benzalacetone;(E)-Benzylideneacetone;(E)-Methyl styryl ketone;Methyl(E)-2-phenylethenyl ketone;Methyl trans-styryl ketone;trans-1-Phenylbut-1-en-3-one;trans-4-Phenyl-3-buten-2-one; |
| CAS: | 1896-62-4 |
| EINECS: | 217-587-6 |
| Molecular Formula: | C10H10O |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.014 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May discolor on exposure to light. |
| Refractive index: | 1.5675 (45 C) |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble in water |
| Appearance: | light yellow low melting crystalline mass |
| Specification: |
?trans-Benzalacetone (CAS NO.1896-62-4) is also named as 4-07-00-01003 (Beilstein Handbook Reference) ; AI3-52291 ; BRN 0742047 ;?Methyl trans-styryl ketone ; TPBO ; trans-4-Phenyl-3-butene-2-one ; trans-Benzalacetone ; trans-Benzylidenacetone ; trans-Benzylideneacetone?.?trans-Benzalacetone (CAS NO.1896-62-4) is light yellow low melting crystalline mass. It is flammable. It will produce?stimulate smoke when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
