| Identification | |
| Name: | Phenol, 4-propoxy- |
| Synonyms: | Phenol,p-propoxy- (7CI,8CI);4-Propyloxyphenol;Hydroquinonemonopropyl ether;NSC 82358;p-Propoxyphenol; |
| CAS: | 18979-50-5 |
| Molecular Formula: | C9H12O2 |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C9H12O2/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6,10H,2,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.05 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.52 |
| Solubility: | Insoluble |
| Appearance: | White to beige crystal |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: |
4-Propoxyphenol (18979-50-5) is used as intermediates of liquid crystals. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
