| Identification | |
| Name: | Phenol, 4-(pentyloxy)- |
| Synonyms: | Phenol,p-(pentyloxy)- (7CI,8CI);4-(Pentyloxy)phenol;p-(Pentyloxy)phenol;p-(n-Pentyloxy)phenol;p-Pentoxyphenol; |
| CAS: | 18979-53-8 |
| EINECS: | 242-712-6 |
| Molecular Formula: | C11H16O2 |
| Molecular Weight: | 180.24 |
| InChI: | InChI=1/C11H16O2/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8,12H,2-4,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136.7°C |
| Boiling Point: | 293.9°Cat760mmHg |
| Density: | 1.013g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.505 |
| Appearance: | Off-white. |
| Specification: |
Store in a cool, dry place. Keep container closed when not in use.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation. |
| Flash Point: | 136.7°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
