| Identification | |
| Name: | Phenol,4-chloro-2-hexyl- |
| Synonyms: | 4-Chloro-2-hexylphenol |
| CAS: | 18979-94-7 |
| Molecular Formula: | C12H17 Cl O |
| Molecular Weight: | 212.74 |
| InChI: | InChI=1/C12H17ClO/c1-2-3-4-5-6-10-9-11(13)7-8-12(10)14/h7-9,14H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135.7°C |
| Boiling Point: | 300.8°C at 760 mmHg |
| Density: | 1.07g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
4-Chloro-2-hexylphenol , its CAS NO. is 18979-94-7, the synonyms are 2-Hexyl-4-chlorophenol ; 3-06-00-01993 (Beilstein Handbook Reference) ; BRN 3253860 ; Phenol, 4-chloro-2-hexyl- . |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. |
| Flash Point: | 135.7°C |
| Safety Data | |
 |
|
