| Identification | |
| Name: | Thiocyanic acid,(4-methylphenyl)methyl ester |
| Synonyms: | Thiocyanicacid, p-methylbenzyl ester (8CI); 4-Methylbenzyl thiocyanate; p-Methylbenzylthiocyanate |
| CAS: | 18991-39-4 |
| Molecular Formula: | C9H9 N S |
| Molecular Weight: | 161.22358 |
| InChI: | InChI=1/C9H9NS/c1-8-2-4-9(5-3-8)6-11-7-10/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.119 g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
p-Methylbenzyl thiocyanate , its cas register number is 18991-39-4. It also can be called 1-Methyl-4-(thiocyanatomethyl)benzene ; and Thiocyanic acid, p-methylbenzyl ester . |
| Safety Data | |
 |
|
