| Identification | |
| Name: | Indole-2-carboxaldehyde |
| Synonyms: | Indole-2-carboxaldehyde(6CI,7CI,8CI);2-Formylindole;Indole-2-carbaldehyde;NSC 71792;1H-Indole-2-carboxaldehyde; |
| CAS: | 19005-93-7 |
| Molecular Formula: | C9H7NO |
| Molecular Weight: | 145.158 |
| InChI: | InChI=1/C9H7NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-6,10H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 138-142 oC |
| Flash Point: | 166.8 oC |
| Boiling Point: | 339.1 oC at 760 mmHg |
| Density: | 1.278 g/cm3 |
| Refractive index: | 1.729 |
| Appearance: | White to tan solid, powder, crystals, crystalline powder and / or chunks |
| Specification: |
Indole-2-carboxaldehyde (CAS NO.19005-93-7), its Synonyms are 1H-Indole-2-carboxaldehyde ; Indole-2-carboxaldehyde(6CI,7CI,8CI) ; 2-Formylindole . |
| Flash Point: | 166.8 oC |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
