| Identification | |
| Name: | 2-METHYL-1-DECANAL |
| Synonyms: | 2-methyl decanal |
| CAS: | 19009-56-4 |
| EINECS: | 242-745-6 |
| Molecular Formula: | C11H22O |
| Molecular Weight: | 170.2918 |
| InChI: | InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-11(2)10-12/h10-11H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 222.5°Cat760mmHg |
| Boiling Point: | 222.5°Cat760mmHg |
| Density: | 0.819g/cm3 |
| Refractive index: | 1.425 |
| Specification: |
2-Methyl-1-decanal ,its cas register number is 19009-56-4. It also can be called (4) 2-Methyldecanal ; 2-Methyldecan-1-al ; Decanal, 2-methyl- ; and Methyloctylacetaldehyde . |
| Report: |
2-Methyl-1-decanal (CAS NO.19009-56-4) has been reported in EPA TSCA Inventory. |
| Flash Point: | 222.5°Cat760mmHg |
| Safety Data | |
 |
|
