| Identification |
| Name: | 1H-Indole-3-carboxaldehyde,1-methyl- |
| Synonyms: | Indole-3-carboxaldehyde,1-methyl- (6CI,8CI);1-Methyl-1H-indole-3-carboxaldehyde;1-Methyl-3-formylindole;3-Formyl-1-methylindole;N-Methyl-3-formylindole;N-Methyl-3-indolecarboxaldehyde;N-Methylindole-3-carbaldehyde;NSC 83042; |
| CAS: | 19012-03-4 |
| EINECS: | 242-750-3 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.18 |
| InChI: | InChI=1/C10H9NO/c1-11-6-8(7-12)9-4-2-3-5-10(9)11/h2-7H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.1 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.585 |
| Appearance: | Odorless light yellow to orange cryst. Powder and chunks solid |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
