| Identification | |
| Name: | 4-(P-methoxyphenyl)thiosemicarba-zone-1h-pyrrole-2-carboxaldehyde |
| Synonyms: | 1H-Pyrrole-2-carboxaldehyde, 4-(p-methoxyphenyl)thiosemicarbazone;Semicarbazide, 4-(p-methoxyphenyl)-1-(2-pyrrolylmethylene)-3-thio-;AC1NUTNS;LS-136674;1-(4-methoxyphenyl)-3-[[(Z)-pyrrol-2-ylidenemethyl]amino]thiourea;Hydrazinecarbothioamide, N-(4-methoxyphenyl)-2-(1H-pyrrol-2-ylmethylene)-;Hydrazinecarbothioamide, N-(4-methoxyphenyl)-2-(1H-pyrrol-2-ylmethylene)- (9CI);19015-11-3 |
| CAS: | 19015-11-3 |
| Molecular Formula: | C13H14N4OS |
| Molecular Weight: | 274.3415 |
| InChI: | InChI=1/C13H14N4OS/c1-18-12-6-4-10(5-7-12)16-13(19)17-15-9-11-3-2-8-14-11/h2-9,15H,1H3,(H2,16,17,19)/b11-9- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 200°C |
| Boiling Point: | 407°C at 760 mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.635 |
| Specification: |
4-(P-methoxyphenyl)thiosemicarba-zone-1h-pyrrole-2-carboxaldehyde ,with CAS number of 119015-11-3,can be called Semicarbazide, 4-(p-methoxyphenyl)-1-(2-pyrrolylmethylene)-3-thio- . |
| Flash Point: | 200°C |
| Safety Data | |
 |
|
