| Identification |
| Name: | Benzenemethanol,2,6-difluoro- |
| Synonyms: | Benzylalcohol, 2,6-difluoro- (8CI);(2,6-Difluorophenyl)methanol;2,6-Difluorobenzenemethanol; |
| CAS: | 19064-18-7 |
| EINECS: | 242-792-2 |
| Molecular Formula: | C7H6F2O |
| Molecular Weight: | 144.12 |
| InChI: | InChI=1/C7H6F2O/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.494-1.497 |
| Appearance: | clear colorless to light yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
