| Identification | |
| Name: | 1(2H)-Pyridinecarboxylicacid, 3,4-dihydro-2-methyl-4-oxo-, phenylmethyl ester |
| Synonyms: | Benzyl 3,4-dihydro-2-methyl-4-oxopyridine-1(2H)-carboxylate;Benzyl 2-methyl-4-oxo-3,4-dihydropyridine-1(2H)-carboxylate; |
| CAS: | 190906-91-3 |
| Molecular Formula: | C14H15NO3 |
| Molecular Weight: | 245.27 |
| InChI: | InChI=1/C14H15NO3/c1-11-9-13(16)7-8-15(11)14(17)18-10-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.192 |
| Refractive index: | 1.56 |
| Specification: |
The Benzyl 3,4-dihydro-2-methyl-4-oxopyridine-1(2H)-carboxylate with the cas number 190906-91-3 is also called 1(2H)-Pyridinecarboxylicacid, 3,4-dihydro-2-methyl-4-oxo-, phenylmethyl ester. The systematic name is benzyl 2-methyl-4-oxo-3,4-dihydropyridine-1(2H)-carboxylate. Its molecular formula is C14H15NO3. The properties of the chemical are: (1)ACD/LogP: 0.77; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 9; (6)ACD/BCF (pH 7.4): 9; (7)ACD/KOC (pH 5.5): 164; (8)ACD/KOC (pH 7.4): 164; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 46.61 Å2; (13)Index of Refraction: 1.56; (14)Molar Refractivity: 66.505 cm3; (15)Molar Volume: 205.613 cm3; (16)Polarizability: 26.365×10-24cm3; (17)Surface Tension: 46.612 dyne/cm; (18)Enthalpy of Vaporization: 63.459 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
