| Identification | |
| Name: | Paraquat dichloride |
| Synonyms: | 1,1'-Dimethyl-4,4'-bipyridiniumdichloride (6CI,7CI);4,4'-Bipyridinium, 1,1'-dimethyl-, dichloride (8CI,9CI);1,1'-Dimethyl-4,4'-dipyridinium dichloride;1,1'-Dimethyl-4,4'-dipyridyliumdichloride;AH 501;AH 501 (herbicide);Cekuquat;Cyclone Max;Dimethylviologen chloride;Galokson;Gramixel;Gramoxone;Gramoxone D;GramoxoneInteon;Gramoxone Max;Gramoxone S;Gramoxone W;Gramoxone dichloride;Methylviologen;Methyl viologen dichloride;Methylviologen chloride;N,N'-Dimethyl-4,4'-bipyridinium dichloride;N,N'-Dimethyl-4,4'-dipyridyliumdichloride;OK 622;Paragreen A;Paraquat;Paraquat dichloride;4,4'-Bipyridinium,1,1'-dimethyl-, chloride (1:2); |
| CAS: | 1910-42-5 |
| EINECS: | 217-615-7 |
| Molecular Formula: | C12H14Cl2N2 |
| Molecular Weight: | 257.15896 |
| InChI: | InChI=1S/C12H14N2.2ClH/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12;;/h3-10H,1-2H3;2*1H/q+2;;/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2588/2811 |
| Melting Point: | 300 oC |
| Flash Point: | 86 |
| Boiling Point: | 175 |
| Density: | 1.25 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | off-white powder |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| Flash Point: | 86 |
| Color: | Colorless solid Yellow solid Off-white powder |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
N: Dangerous for the environment
|
 |
|
