| Identification | |
| Name: | Atrazine |
| CAS: | 1912-24-9 |
| EINECS: | 217-617-8 |
| Molecular Formula: | C8H14ClN5 |
| Molecular Weight: | 215.683 |
| InChI: | InChI=1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3077 |
| Density: | 1.187 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.589 |
| Water Solubility: | Slightly soluble. 0.007 g/100 mL |
| Solubility: | Slightly soluble. 0.007 g/100 mL |
| Appearance: | colourless crystals or white powder |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Color: | Colorless powder Colorless or white, crystalline powder. |
| Usage: | Selective herbicide. Potential symptoms of overexposure are irritation of eyes and skin; dermatitis, skin sensitization; dyspnea, weakness, incoordination, salivation; hypothermia; liver injury |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
