| Identification | |
| Name: | 1-Deoxynojirimycin |
| Synonyms: | UNII-FZ56898FLE;1,5-Deoxy-1,5-imino-D-mannitol; |
| CAS: | 19130-96-2 |
| Molecular Formula: | C6H13NO4 |
| Molecular Weight: | 163.17172 |
| InChI: | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.456 g/cm3 |
| Stability: | Stable if stored as directed. |
| Refractive index: | 1.582 |
| Water Solubility: | Soluble in water. |
| Solubility: | Soluble in water. |
| Appearance: | White Solid |
| Specification: |
?1-Deoxynojirimycin , its cas register number is 19130-96-2. It also can be called?1,5-Deoxy-1,5-imino-D-mannitol ; 1-Deoxymannojirimycin ;?UNII-FZ56898FLE ; 3,4,5-Piperidinetriol, 2-(hydroxymethyl)-, (2R-(2alpha,3beta,4alpha,5beta))- .It is a?white crystalline solid. |
| Biological Activity: | Inhibitor of glucosidase I (K i = 2.1 mM) and II (K i = 7 mM). |
| Storage Temperature: | This product should be stored at 0 C. It should be kept in a tightly closed container. |
| Usage: | 1-Deoxynojirimycin (CAS NO.19130-96-2) is an alpha-glucosidase inhibitor with antiviral action. |
| Safety Data | |
 |
|
