| Identification | |
| Name: | Benzenecarbothioamide,2,6-dichloro- |
| Synonyms: | Benzamide,2,6-dichlorothio- (7CI,8CI); 2,6-Dichlorothiobenzamide; Chlorthiamid;Chlorthiamide; DCBN; Prefix; SD 7961 |
| CAS: | 1918-13-4 |
| EINECS: | 217-637-7 |
| Molecular Formula: | C7H5 Cl2 N S |
| Molecular Weight: | 206.093 |
| InChI: | InChI=1S/C7H5Cl2NS/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 151-152°C |
| Flash Point: | 147.7°C |
| Boiling Point: | 320.6°Cat760mmHg |
| Density: | 1.473g/cm3 |
| Refractive index: | 1.669 |
| Specification: |
2,6-Dichlorothiobenzamide ,its cas register number is 1918-13-4. It also can be called Benzenecarbothioamide, 2,6-dichloro- (9CI) ; and Benzamide, 2,6-dichlorothio- . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 147.7°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
