Identification |
Name: | Benzenecarbothioamide,2,6-dichloro- |
Synonyms: | Benzamide,2,6-dichlorothio- (7CI,8CI); 2,6-Dichlorothiobenzamide; Chlorthiamid;Chlorthiamide; DCBN; Prefix; SD 7961 |
CAS: | 1918-13-4 |
EINECS: | 217-637-7 |
Molecular Formula: | C7H5 Cl2 N S |
Molecular Weight: | 206.093 |
InChI: | InChI=1S/C7H5Cl2NS/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
Molecular Structure: |
 |
Properties |
Melting Point: | 151-152°C |
Flash Point: | 147.7°C |
Boiling Point: | 320.6°Cat760mmHg |
Density: | 1.473g/cm3 |
Refractive index: | 1.669 |
Specification: |
2,6-Dichlorothiobenzamide ,its cas register number is 1918-13-4. It also can be called Benzenecarbothioamide, 2,6-dichloro- (9CI) ; and Benzamide, 2,6-dichlorothio- .
|
Report: |
EPA Genetic Toxicology Program.
|
Flash Point: | 147.7°C |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
 |