| Identification | |
| Name: | Propachlor (2-Chloro-N-(1-methylethyl)-N-phenylacetamide) |
| Synonyms: | Acetanilide,2-chloro-N-isopropyl- (8CI);2-Chloro-N-isopropyl-N-phenylacetamide;2-Chloro-N-isopropylacetanilide;Acilid;Albrass;Bexton;Bexton 4L;CP 31393;Kartex A;Muharicid;N-Isopropyl-2-chloroacetanilide;N-Isopropyl-a-chloroacetanilide;Niticid;Propachlor;Propachlore;Ramrod;Ramrod 65;Ramrod Flo;Satecid;a-Chloro-N-isopropylacetanilide; |
| CAS: | 1918-16-7 |
| EINECS: | 217-638-2 |
| Molecular Formula: | C11H14 Cl N O |
| Molecular Weight: | 211.69 |
| InChI: | InChI=1/C11H14ClNO/c1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.139 g/cm3 |
| Stability: | Stable for at least 4 years, not sensitive to light stable to UV light. |
| Refractive index: | 1.549 |
| Solubility: | Insoluble |
| Appearance: | Light tan crystalline powder. |
| Report: |
EPA Genetic Toxicology Program. |
| Storage Temperature: | 0-6°C |
| Color: | Light tan solid WHITE, CRYSTALLINE SOLID |
| Usage: | Herbicide for grasses & broadleaf weeds on corn, sorghum, soybeans, sugar beets and other field crops, forage crops, pasture land, & range land, summer fallow, & on vegetables. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
