| Identification | |
| Name: | 2-Thiopheneacetic acid |
| Synonyms: | 2-Thenylacetic acid; Thiophene-2-acetic acid, (2-Thienylacetic acid); 2-Thienylacetic acid; thiophen-2-acetic acid; Thiophene-2-acetic acid; Thien-2-ylacetate |
| CAS: | 1918-77-0 |
| EINECS: | 217-639-8 |
| Molecular Formula: | C6H6O2S |
| Molecular Weight: | 142.17 |
| InChI: | InChI=1/C6H6O2S/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Flash Point: | 116.6 oC |
| Density: | 1.336 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?2-Thiopheneacetic acid (CAS NO.1918-77-0), its Synonyms are 2-Thienylacetic acid ; Thiopheneacetic acid ; 2-(2-Thienyl)aceticacid ; 2-(Thiophen-2-yl)acetic acid ; Thiophen-2-ylacetic acid ; 2-Thienylethanoicacid . |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Flash Point: | 116.6 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
