| Identification |
| Name: | 6-({[(2-aminoethyl)sulfanyl]carbonyl}sulfanyl)hexanoic acid hydrochloride (1:1) |
| Synonyms: | Dithiocarbonic acid S-(2-aminoethyl) ester S-ester with 6-mercaptohexanoic acid hydrochloride;6-({[(2-aminoethyl)sulfanyl]carbonyl}sulfanyl)hexanoic acid hydrochloride(1:1);Carbonic acid, dithio-, S-(2-aminoethyl) ester, S-ester with 6-mercaptohexanoic acid, hydrochloride;AC1L4LYG;AC1Q3EHC;AR-1G9653;LS-51990;6-(2-aminoethylsulfanylcarbonylsulfanyl)hexanoic acid hydrochloride |
| CAS: | 19213-27-5 |
| Molecular Formula: | C9H18ClNO3S2 |
| Molecular Weight: | 287.8271 |
| InChI: | InChI=1/C9H17NO3S2.ClH/c10-5-7-15-9(13)14-6-3-1-2-4-8(11)12;/h1-7,10H2,(H,11,12);1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 205.6°C |
| Boiling Point: | 416.4°C at 760 mmHg |
| Flash Point: | 205.6°C |
| Safety Data |
| |
 |
