Identification |
Name: | Methanone,[4-(4-amino-6,7-dimethoxy-2-quinazolinyl)-1-piperazinyl]-2-furanyl- |
Synonyms: | Piperazine,1-(4-amino-6,7-dimethoxy-2-quinazolinyl)-4-(2-furanylcarbonyl)- (9CI);Piperazine, 1-(4-amino-6,7-dimethoxy-2-quinazolinyl)-4-(2-furoyl)- (8CI);4-(4-Amino-6,7-dimethoxyquinazolin-2-yl)piperazinyl 2-furyl ketone; Furazosin;Lentopres; Prazosin |
CAS: | 19216-56-9 |
EINECS: | 242-885-8 |
Molecular Formula: | C19H21 N5 O4 |
Molecular Weight: | 383.45 |
InChI: | InChI=1/C19H21N5O4/c1-26-15-10-12-13(11-16(15)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)14-4-3-9-28-14/h3-4,9-11H,5-8H2,1-2H3,(H2,20,21,22) |
Molecular Structure: |
|
Properties |
Melting Point: | 278-280 ºC |
Flash Point: | 339.9°C |
Boiling Point: | 638.4°Cat760mmHg |
Density: | 1.352g/cm3 |
Refractive index: | 1.651 |
Solubility: | Soluble at ambient temperatures (mg/ml): acetone, 0.0072; methanol, 6.4; ethanol, 0.84; dimethylformamide, 1.3; dimethylacetamide, 1.2; chloroform, 0.041 In water, 1.4 mg/ml @ pH approx 3.5 |
Specification: |
Prazosin is a sympatholytic drug used to treat high blood pressure (hypertension). It belongs to the class of alpha-adrenergic blockers, which lower blood pressure by relaxing blood vessels. Specifically, prazosin is selective for the alpha-1 receptors on vascular smooth muscle. These receptors are responsible for the vasoconstrictive action of norepinephrine, which would normally raise blood pressure. By blocking these receptors, prazosin reduces blood pressure.
|
Flash Point: | 339.9°C |
Color: | White to tan powder |
Safety Data |
|
|