| Identification |
| Name: | 2-Methyl-5-chlorobenzoxazole |
| Synonyms: | 5-Chloro-2-methylbenzoxazole |
| CAS: | 19219-99-9 |
| EINECS: | 242-888-4 |
| Molecular Formula: | C8H6ClNO |
| Molecular Weight: | 167.59234 |
| InChI: | InChI=1S/C8H6ClNO/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1759 |
| Density: | 1.311 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.608 |
| Water Solubility: | freely soluble in organic solvents |
| Solubility: | freely soluble in organic solvents |
| Appearance: | Colorless oil liquid to white crystals |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
