Identification |
Name: | Benzoic acid,4-[[3-(1,6-dihydro-6-oxo-9H-purin-9-yl)-1-oxopropyl]amino]-, potassium salt(1:1) |
Synonyms: | Benzoicacid, 4-[[3-(1,6-dihydro-6-oxo-9H-purin-9-yl)-1-oxopropyl]amino]-,monopotassium salt (9CI); AIT 082; Leteprinim potassium; Neotrofin |
CAS: | 192564-13-9 |
Molecular Formula: | C15H13 N5 O4 . K |
Molecular Weight: | 0 |
InChI: | InChI=1/C15H13N5O4.K/c21-11(19-10-3-1-9(2-4-10)15(23)24)5-6-20-8-18-12-13(20)16-7-17-14(12)22;/h1-4,7-8H,5-6H2,(H,19,21)(H,23,24)(H,16,17,22);/q;+1/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Flash Point: | °C |
Usage: | A synthetic purine derivative with neuroprotective effects. A cognitive enhancer, is transported into brain by a nonsaturable influx mechanism and out of brain by a saturable efflux mechanism. |
Safety Data |
|
|