| Identification | |
| Name: | Acetic acid,2-(2,4-dichlorophenoxy)-, octyl ester |
| Synonyms: | Aceticacid, (2,4-dichlorophenoxy)-, octyl ester (6CI,7CI,8CI,9CI); 2,4-D octyl ester;NSC 78930; Octyl 2,4-dichlorophenoxyacetate |
| CAS: | 1928-44-5 |
| EINECS: | 217-674-9 |
| Molecular Formula: | C16H22 Cl2 O3 |
| Molecular Weight: | 333.25 |
| InChI: | InChI=1/C16H22Cl2O3/c1-2-3-4-5-6-7-10-20-16(19)12-21-15-9-8-13(17)11-14(15)18/h8-9,11H,2-7,10,12H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139.6°C |
| Boiling Point: | 401.7°Cat760mmHg |
| Density: | 1.151g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.507 |
| Specification: |
Octyl 2,4-dichlorophenoxyacetate (CAS NO.1928-44-5) is also called 2,4-D Octyl ester ; 2,4-D-Octyl ester ; 2,4-D-octyl ; 2,4-Dichlorphenoxyacetic acid octyl ester ; 3-06-00-00706 (Beilstein Handbook Reference) ; AI3-16687 ; Acetic acid, 2,4-dichlorophenoxy-, octyl ester ; BRN 2336407 ; NSC 78930 ; Octyl ester of 2,4-D ; Oktylester 2,4-dichlorfenoxyoctove ; Oktylester 2,4-dichlorfenoxyoctove [Czech] . |
| Flash Point: | 139.6°C |
| Storage Temperature: | Store at ambient temperatures with open venting. |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols | |
 |
|
