| Identification | |
| Name: | 2,4-Dichlorophenoxyacetic acid, propylene glycol butyl |
| Synonyms: | 3-Butoxypropyl (2,4-dichlorophenoxy)acetate;acetic acid, 2-(2,4-dichlorophenoxy)-, 3-butoxypropyl ester |
| CAS: | 1928-45-6 |
| Molecular Formula: | C15H20Cl2O4 |
| Molecular Weight: | 335.2229 |
| InChI: | InChI=1/C15H20Cl2O4/c1-2-3-7-19-8-4-9-20-15(18)11-21-14-6-5-12(16)10-13(14)17/h5-6,10H,2-4,7-9,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.8°C |
| Boiling Point: | 420.4°C at 760 mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.508 |
| Solubility: | Soluble in oils /2,4-D esters/ |
| Specification: |
2,4-Dichlorophenoxyacetic acid, propylene glycol butyl ,its cas register number is 1928-45-6. It also can be called Butoxypropyl 2,4-dichlorphenoxyacetate ; 2,4-D-3-butoxypropyl [ISO] ;and 2,4-D, butoxypropyl ester . |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. |
| Flash Point: | 152.8°C |
| Safety Data | |
 |
|
