Identification |
Name: | 2-Propenoicacid, 2-methyl-, 4-(benzoylamino)-7-oxo-1,3,5-cycloheptatrien-1-yl ester |
Synonyms: | Methacrylicacid, ester with N-(4-hydroxy-5-oxo-1,3,6-cycloheptatrien-1-yl)benzamide (8CI);Benzamide, N-(4-hydroxy-5-oxo-1,3,6-cycloheptatrien-1-yl)-, methacrylate(ester); NSC 79558; NSC 85780 |
CAS: | 19281-38-0 |
Molecular Formula: | C18H15 N O4 |
Molecular Weight: | 309.316 |
InChI: | InChI=1/C18H15NO4/c1-12(2)18(22)23-16-11-9-14(8-10-15(16)20)19-17(21)13-6-4-3-5-7-13/h3-11H,1H2,2H3,(H,19,21) |
Molecular Structure: |
![(C18H15NO4) Methacrylicacid, ester with N-(4-hydroxy-5-oxo-1,3,6-cycloheptatrien-1-yl)benzamide (8CI);Benzamide,...](https://img1.guidechem.com/chem/e/dict/50/19281-38-0.jpg) |
Properties |
Flash Point: | 262.4°C |
Boiling Point: | 510.2°Cat760mmHg |
Density: | 1.25g/cm3 |
Refractive index: | 1.601 |
Flash Point: | 262.4°C |
Safety Data |
|
![](/images/detail_15.png) |