| Identification | |
| Name: | 2,4-D butoxyethyl ester |
| Synonyms: | Aceticacid, (2,4-dichlorophenoxy)-, 2-butoxyethyl ester (6CI,8CI,9CI); Ethanol,2-butoxy-, (2,4-dichlorophenoxy)acetate (8CI); 2,4-D 2-Butoxyethyl ester; 2,4-DButotyl; 2,4-D Butoxyethanol ester; 2,4-D Butoxyethyl ester; 2,4-DBEE;2,4-Dichlorophenoxyacetic acid butoxyethanol ester; 2,4-Dichlorophenoxyaceticacid butoxyethyl ester; 2-Butoxyethyl 2,4-dichlorophenoxyacetate; Aqua-Kleen;Bladex B; Brush Killer 64; Butoxyethanol ester of 2,4-D; Butoxyethyl(2,4-dichlorophenoxy)acetate; Planotox; Weedone LV 4 |
| CAS: | 1929-73-3 |
| EINECS: | 217-680-1 |
| Molecular Formula: | C14H18 Cl2 O4 |
| Molecular Weight: | 321.22 |
| InChI: | InChI=1/C14H18Cl2O4/c1-2-3-6-18-7-8-19-14(17)10-20-13-5-4-11(15)9-12(13)16/h4-5,9H,2-3,6-8,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Melting Point: | 157 |
| Flash Point: | 152.9°C |
| Boiling Point: | 409.3°Cat760mmHg |
| Density: | 1.222g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.6074 (20 C) |
| Solubility: | 12 mg/L |
| Appearance: | Amber liquid. Odorless when pure. |
| Packinggroup: | III |
| Flash Point: | 152.9°C |
| Storage Temperature: | Store at ambient temperatures with open venting. |
| Color: | Amber liquid Viscous, colorless liquid |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
