| Identification | |
| Name: | 1-Isocyano-4-methyl-3-nitrobenzene |
| Synonyms: | 1-Isocyano-4-methyl-3-nitrobenzene;4-isocyano-1-methyl-2-nitrobenzene;Benzene, 1-isocyano-4-methyl-3-nitro-;1930-92-3;AC1L3SD7;AR-1G2948;AKOS006276862;LS-30402 |
| CAS: | 1930-92-3 |
| Molecular Formula: | C8H6N2O2 |
| Molecular Weight: | 162.1454 |
| InChI: | InChI=1/C8H6N2O2/c1-6-3-4-7(9-2)5-8(6)10(11)12/h3-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
1-Isocyano-4-methyl-3-nitrobenzene with cas registry number of 1930-92-3 is also known as 1-Isocyano-4-methyl-3-nitrobenzene ; Benzene, 1-isocyano-4-methyl-3-nitro- . It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, dry place. 1-Isocyano-4-methyl-3-nitrobenzene with cas registry number of 1930-92-3 is an agricultural chemical which is used as a insecticide . It is also an intermediate in synthesis of many useful compounds. |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
