| Identification | |
| Name: | 1-Naphthalenol,potassium salt (1:1) |
| Synonyms: | 1-Naphthalenol,potassium salt (9CI); 1-Naphthol, potassium salt (8CI); Potassium 1-naphthoxide(6CI); Potassium 1-naphtholate |
| CAS: | 19402-71-2 |
| EINECS: | 243-036-4 |
| Molecular Formula: | C10H8 O . K |
| Molecular Weight: | 182.26028 |
| InChI: | InChI=1/C10H8O.K/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7,11H;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 96 deg C |
| Density: | 1.181g/cm3 |
| Solubility: | In water, 866 mg/L at 25 deg C Very soluble in ethanol and ether, soluble in acetone Freely soluble in benzene, chloroform and alkali hydroxide solutions |
| Color: | Yellow monoclinic needles from water Colorless prisms (from toluene) |
| Safety Data | |
 |
|
