| Identification | |
| Name: | Propene-1,3-diol diacetate |
| Synonyms: | Diacetic acid 1-propene-1,3-diyl ester;1,3-DIACETOXYPROPENE |
| CAS: | 1945-91-1 |
| Molecular Formula: | C7H10O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H10O4/c1-6(8)10-4-3-5-11-7(2)9/h3-4H,5H2,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107.5°C |
| Boiling Point: | 224.6°C at 760 mmHg |
| Density: | 1.093g/cm3 |
| Refractive index: | 1.439 |
| Specification: |
Propene-1,3-diol diacetate , its cas register number is 1945-91-1. It also can be called 1,3-Diacetoxypropene ; 1,3-Diacetyloxypropene ; NSC 16185 . When heated to decomposition it emits acrid smoke and irritating fumes. Propene-1,3-diol diacetate (CAS NO.1945-91-1) will cause a severe skin and eye irritant. |
| Flash Point: | 107.5°C |
| Safety Data | |
 |
|
