| Identification | |
| Name: | Propanoic acid,2-methyl-, potassium salt (1:1) |
| Synonyms: | Isobutyricacid, potassium salt (8CI);Propanoic acid, 2-methyl-, potassium salt (9CI);Potassium 2-methylpropanoate;Potassium isobutyrate; |
| CAS: | 19455-20-0 |
| EINECS: | 243-077-8 |
| Molecular Formula: | C4H7KO2 |
| Molecular Weight: | 126.2 |
| InChI: | InChI=1S/C4H8O2.K/c1-3(2)4(5)6;/h3H,1-2H3,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 58.2°C |
| Boiling Point: | 155.2°Cat760mmHg |
| Density: | 0.983g/cm3 |
| Solubility: | Slightly soluble in carbon tetrachloride Sol in 6 parts of water; miscible with alcohol, chloroform, and ether. In water, 1.67X10+5 mg/L at 20 deg C |
| Flash Point: | 58.2°C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
