| Identification |
| Name: | carbonothioic acid, O-ethyl S-[[(phenylmethyl)amino]thioxomethyl] ester |
| Synonyms: | BRN 2653386;Thiocarbonic acid anhydrosulfide with benzyldithiocarbamic acid ethyl ester;CARBONIC ACID, THIO-, ANHYDROSULFIDE with BENZYLDITHIOCARBAMIC ACID, ETHYL ESTER;AC1MHUKT;ethyl benzylcarbamothioylsulfanylformate;LS-52104;19457-08-0 |
| CAS: | 19457-08-0 |
| Molecular Formula: | C11H13NO2S2 |
| Molecular Weight: | 255.3564 |
| InChI: | InChI=1/C11H13NO2S2/c1-2-14-11(13)16-10(15)12-8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,12,15) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 177.3°C |
| Boiling Point: | 369.6°C at 760 mmHg |
| Density: | 1.257g/cm3 |
| Refractive index: | 1.609 |
| Flash Point: | 177.3°C |
| Safety Data |
| |
 |
