| Identification | |
| Name: | 4-((P-(dimethylamino)phenyl)azo)-2,5-lutidine 1-oxide |
| Synonyms: | 4-[[p-(Dimethylamino)phenyl]azo]-2,5-dimethylpyridine 1-oxide |
| CAS: | 19471-27-3 |
| Molecular Formula: | C15H18N4O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H18N4O/c1-11-10-19(20)12(2)9-15(11)17-16-13-5-7-14(8-6-13)18(3)4/h5-10H,1-4H3/b17-16+ |
| Molecular Structure: | ![(C15H18N4O) 4-[[p-(Dimethylamino)phenyl]azo]-2,5-dimethylpyridine 1-oxide](https://img.guidechem.com/crawlimg/19471-27-3.png) |
| Properties | |
| Flash Point: | 264.5°C |
| Boiling Point: | 513.7°C at 760 mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.581 |
| Specification: |
4-((P-(dimethylamino)phenyl)azo)-2,5-lutidine 1-oxide ,with CAS number of 19471-27-3,can be called N,N-Dimethyl-4-(4'-(2',5'-dimethylpyridyl-1'-oxide)azo)aniline . |
| Report: |
4-((P-(dimethylamino)phenyl)azo)-2,5-lutidine 1-oxide (CAS NO.19471-27-3) was reported in JNCIAM Journal of the National Cancer Institute. |
| Flash Point: | 264.5°C |
| Safety Data | |
 |
|
