| Identification | |
| Name: | D-lyxo-Hexose, 2-deoxy- |
| Synonyms: | D-2-Deoxygalactose;2-Deoxygalactose;D-2-Desoxygalactose;Galactose, 2-deoxy-;Galactose,2-deoxy-, D- (6CI);2-Deoxy-D-lyxo-hexose; |
| CAS: | 1949-89-9 |
| EINECS: | 217-765-3 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 164.16 |
| InChI: | InChI=1/C6H12O5/c7-2-1-4(9)6(11)5(10)3-8/h2,4-6,8-11H,1,3H2/t4-,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.533 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.58 |
| Alpha: | 57 º (C=3.7, H20 NH3) |
| Solubility: | Very soluble |
| Appearance: | White Crystalline Solid |
| Specification: |
2-Deoxy-D-galactose , with CAS number of 1949-89-9, can be called Deoxy-d-galactose,2-;2-deoxy-d-lyxohexose ; 2-deoxy-d-galactopyranose ; 2-deoxy-d-galactose ; 2-deoxygalactose ; 2-deoxy-beta-d-galactose ; 2-deoxy-beta-d-lyxo-hexose ; 2-deoxy-d-galactose (1.24798) . 2-Deoxy-D-galactose (CAS NO.1949-89-9) is a white Crystalline Solid. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
