| Identification |
| Name: | 4-Methoxyphenylhydrazine hydrochloride |
| Synonyms: | 4-Methoxyphenyhydrozine HCL; 4-Hydrozinobenzeno Sulfonamide HCL |
| CAS: | 19501-58-7 |
| EINECS: | 243-115-3 |
| Molecular Formula: | C7H10N2O?HCl |
| Molecular Weight: | 174.63 |
| InChI: | InChI=1/C7H10N2O.ClH/c1-10-7-4-2-6(9-8)3-5-7;/h2-5,9H,8H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Density: | 1.15g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Iron grey to micro red powder |
| Packinggroup: | III |
| HS Code: | 29280090 |
| Storage Temperature: | Keep Cold |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
