Identification |
Name: | 3H-Furo[4,3,2-de]indeno[4,5-h]-2-benzopyran-3,6,9-trione,11-(acetyloxy)-1,6b,7,8,9a,10,11,11b-octahydro-1-(methoxymethyl)-9a,11b-dimethyl-,(1S,6bR,9aS,11R,11bR)- |
Synonyms: | 3H-Furo[4,3,2-de]indeno[4,5-h]-2-benzopyran-3,6,9-trione,11-(acetyloxy)-1,6b,7,8,9a,10,11,11b-octahydro-1-(methoxymethyl)-9a,11b-dimethyl-,[1S-(1a,6ba,9ab,11a,11bb)]-;(+)-Wortmannin;KY 12420;Wortmannin; |
CAS: | 19545-26-7 |
EINECS: | 214-538-0 |
Molecular Formula: | C23H24O8 |
Molecular Weight: | 428.43186 |
InChI: | InChI=1S/C23H24O8/c1-10(24)30-13-7-22(2)12(5-6-14(22)25)16-18(13)23(3)15(9-28-4)31-21(27)11-8-29-20(17(11)23)19(16)26/h8,12-13,15H,5-7,9H2,1-4H3/t12?,13-,15-,22+,23+/m1/s1 |
Molecular Structure: |
![(C23H24O8) 3H-Furo[4,3,2-de]indeno[4,5-h]-2-benzopyran-3,6,9-trione,11-(acetyloxy)-1,6b,7,8,9a,10,11,11b-octahy...](https://img1.guidechem.com/chem/e/dict/60/19545-26-7.jpg) |
Properties |
Transport: | UN 3462 |
Density: | 1.39 g/cm3 |
Refractive index: | 1.591 |
Water Solubility: | DMSO: soluble |
Solubility: | DMSO: soluble |
Appearance: | White solid |
Biological Activity: | Potent, selective, cell-permeable and irreversible inhibitor of phosphatidylinositol 3-kinase (PI 3-kinase) (IC 50 = 2-4 nM). Also potently inhibits polo-like kinase 1 (PLK1) (IC 50 = 5.8 nM). |
Storage Temperature: | 2-8°C |
Color: | off-white |
Safety Data |
Hazard Symbols |
T+: Very toxic
T: Toxic
|
|
![](/images/detail_15.png) |