Identification |
Name: | L-Valine, glycyl- |
Synonyms: | L-Valine,N-glycyl-;Valine, N-glycyl-, L- (8CI);Glycylvaline;N-Glycyl-L-valine;NSC 163327;NSC 83255;H-Gly-Val-OH; |
CAS: | 1963-21-9 |
EINECS: | 217-806-5 |
Molecular Formula: | C7H14N2O3 |
Molecular Weight: | 174.2 |
InChI: | InChI=1/C7H14N2O3/c1-4(2)6(7(11)12)9-5(10)3-8/h4,6H,3,8H2,1-2H3,(H,9,10)(H,11,12) |
Molecular Structure: |
|
Properties |
Density: | 1.168 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | -20 ° (C=2, H2O) |
Alpha: | -21 º (C=2,WATER) |
Solubility: | 550 g/L (20 ºC) |
Appearance: | White solid. |
Specification: |
L-Valine, glycyl- , its cas register number is 1963-21-9. It also can be called Glycyl-L-valine ; Gly-Val ; N-Glycyl-L-valine .It is a white fine crystalline powder.
|
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|