| Identification | |
| Name: | 1H-Benzimidazole,6-bromo-2-methyl- |
| Synonyms: | 1H-Benzimidazole,5-bromo-2-methyl- (9CI);Benzimidazole, 5(or 6)-bromo-2-methyl- (6CI,7CI);Benzimidazole, 5-bromo-2-methyl- (8CI);2-Methyl-5-bromobenzimidazole;5-Bromo-2-methylbenzimidazole; |
| CAS: | 1964-77-8 |
| Molecular Formula: | C8H7BrN2 |
| Molecular Weight: | 211.06 |
| InChI: | InChI=1/C8H7BrN2/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.654 g/cm3 |
| Refractive index: | 1.696 |
| Specification: |
The cas register number of 5-Bromo-2-methyl-1H-benzo[d]imidazole is 1964-77-8. It also can be called as 1H-benzimidazole, 5-bromo-2-methyl- and the Systematic name about this chemical is 6-bromo-2-methyl-1H-benzimidazole. Physical properties about 5-Bromo-2-methyl-1H-benzo[d]imidazole are: (1)ACD/LogP: 2.35 ; (2)# of Rule of 5 Violations: 0 ; (3)ACD/LogD (pH 5.5): 2.13 ; (4)ACD/LogD (pH 7.4): 2.34 ; (5)ACD/BCF (pH 5.5): 21.67; (6)ACD/BCF (pH 7.4): 35.45; (7)ACD/KOC (pH 5.5): 272.99; (8)ACD/KOC (pH 7.4): 446.45; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 17.82Å2; (13)Index of Refraction: 1.696; (14)Molar Refractivity: 49.13 cm3; (15)Molar Volume: 127.5 cm3; (16)Surface Tension: 58.6 dyne/cm; (17)Density: 1.654 g/cm3; (18)Flash Point: 194.1 °C; (19)Enthalpy of Vaporization: 62.25 kJ/mol; (20)Boiling Point: 397.3 °C at 760 mmHg; (21)Vapour Pressure: 3.66E-06 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
